Carboxylic acids and derivatives
Filtered Search Results
2-Aminoethyl methacrylate hydrochloride, 90%, stabilized
CAS: 2420-94-2 Molecular Formula: C6H11NO2·HCl Molecular Weight (g/mol): 165.62 MDL Number: MFCD00078260 InChI Key: XSHISXQEKIKSGC-UHFFFAOYSA-N Synonym: 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 PubChem CID: 75495 IUPAC Name: 2-aminoethyl 2-methylprop-2-enoate;hydrochloride SMILES: CC(=C)C(=O)OCCN.Cl
| PubChem CID | 75495 |
|---|---|
| CAS | 2420-94-2 |
| Molecular Weight (g/mol) | 165.62 |
| MDL Number | MFCD00078260 |
| SMILES | CC(=C)C(=O)OCCN.Cl |
| Synonym | 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 |
| IUPAC Name | 2-aminoethyl 2-methylprop-2-enoate;hydrochloride |
| InChI Key | XSHISXQEKIKSGC-UHFFFAOYSA-N |
| Molecular Formula | C6H11NO2·HCl |
Methyl DL-lactate, 99%
CAS: 547-64-8 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.105 MDL Number: MFCD00066367 InChI Key: LPEKGGXMPWTOCB-UHFFFAOYSA-N Synonym: methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate PubChem CID: 11040 ChEBI: CHEBI:83221 IUPAC Name: methyl 2-hydroxypropanoate SMILES: CC(C(=O)OC)O
| PubChem CID | 11040 |
|---|---|
| CAS | 547-64-8 |
| Molecular Weight (g/mol) | 104.105 |
| ChEBI | CHEBI:83221 |
| MDL Number | MFCD00066367 |
| SMILES | CC(C(=O)OC)O |
| Synonym | methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate |
| IUPAC Name | methyl 2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
Ethyl mercaptoacetate, 98+%
CAS: 623-51-8 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.166 MDL Number: MFCD00004874 InChI Key: PVBRSNZAOAJRKO-UHFFFAOYSA-N Synonym: ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester PubChem CID: 12185 IUPAC Name: ethyl 2-sulfanylacetate SMILES: CCOC(=O)CS
| PubChem CID | 12185 |
|---|---|
| CAS | 623-51-8 |
| Molecular Weight (g/mol) | 120.166 |
| MDL Number | MFCD00004874 |
| SMILES | CCOC(=O)CS |
| Synonym | ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester |
| IUPAC Name | ethyl 2-sulfanylacetate |
| InChI Key | PVBRSNZAOAJRKO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
N,N-Diethylformamide, 99%
CAS: 617-84-5 Molecular Formula: C5H11NO Molecular Weight (g/mol): 101.15 MDL Number: MFCD00003287 InChI Key: SUAKHGWARZSWIH-UHFFFAOYSA-N Synonym: diethylformamide,formamide, n,n-diethyl,n-formyldiethylamine,diethyl formamide,formyldiethylamine,diethylamid kyseliny mravenci,n,n-diethylcarboxamide,diethylamid kyseliny mravenci czech,diethyl-formamide,formamide, diethyl PubChem CID: 12051 IUPAC Name: N,N-diethylformamide SMILES: CCN(CC)C=O
| PubChem CID | 12051 |
|---|---|
| CAS | 617-84-5 |
| Molecular Weight (g/mol) | 101.15 |
| MDL Number | MFCD00003287 |
| SMILES | CCN(CC)C=O |
| Synonym | diethylformamide,formamide, n,n-diethyl,n-formyldiethylamine,diethyl formamide,formyldiethylamine,diethylamid kyseliny mravenci,n,n-diethylcarboxamide,diethylamid kyseliny mravenci czech,diethyl-formamide,formamide, diethyl |
| IUPAC Name | N,N-diethylformamide |
| InChI Key | SUAKHGWARZSWIH-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO |
2-(2-Cyanophenoxy)acetamide, 98%
CAS: 54802-12-9 Molecular Formula: C9H8N2O2 Molecular Weight (g/mol): 176.175 MDL Number: MFCD00297091 InChI Key: RYOYNMJXEHNYAG-UHFFFAOYSA-N Synonym: 2-2-cyanophenoxy acetamide,acetamide, 2-2-cyanophenoxy,2-cyanophenoxyacetamide PubChem CID: 12353988 IUPAC Name: 2-(2-cyanophenoxy)acetamide SMILES: C1=CC=C(C(=C1)C#N)OCC(=O)N
| PubChem CID | 12353988 |
|---|---|
| CAS | 54802-12-9 |
| Molecular Weight (g/mol) | 176.175 |
| MDL Number | MFCD00297091 |
| SMILES | C1=CC=C(C(=C1)C#N)OCC(=O)N |
| Synonym | 2-2-cyanophenoxy acetamide,acetamide, 2-2-cyanophenoxy,2-cyanophenoxyacetamide |
| IUPAC Name | 2-(2-cyanophenoxy)acetamide |
| InChI Key | RYOYNMJXEHNYAG-UHFFFAOYSA-N |
| Molecular Formula | C9H8N2O2 |
Sodium Succinate, Anhydrous, Reagent, 99-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 150-90-3 Molecular Formula: C4H4Na2O4 Molecular Weight (g/mol): 162.05 InChI Key: ZDQYSKICYIVCPN-UHFFFAOYSA-L IUPAC Name: disodium butanedioate SMILES: [Na+].[Na+].[O-]C(=O)CCC([O-])=O
| CAS | 150-90-3 |
|---|---|
| Molecular Weight (g/mol) | 162.05 |
| SMILES | [Na+].[Na+].[O-]C(=O)CCC([O-])=O |
| IUPAC Name | disodium butanedioate |
| InChI Key | ZDQYSKICYIVCPN-UHFFFAOYSA-L |
| Molecular Formula | C4H4Na2O4 |
N-Hydroxyphthalimide, 98%
CAS: 524-38-9 Molecular Formula: C8H5NO3 Molecular Weight (g/mol): 163.13 MDL Number: MFCD00005891 InChI Key: CFMZSMGAMPBRBE-UHFFFAOYSA-N Synonym: n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione PubChem CID: 10665 IUPAC Name: 2-hydroxyisoindole-1,3-dione SMILES: ON1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 10665 |
|---|---|
| CAS | 524-38-9 |
| Molecular Weight (g/mol) | 163.13 |
| MDL Number | MFCD00005891 |
| SMILES | ON1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione |
| IUPAC Name | 2-hydroxyisoindole-1,3-dione |
| InChI Key | CFMZSMGAMPBRBE-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO3 |
MilliporeSigma™ 2',7'-Dichlorofluorescin Diacetate, Calbiochem™,
CAS: 4091-99-0 Molecular Formula: C24H16Cl2O7 Molecular Weight (g/mol): 487.285 InChI Key: PXEZTIWVRVSYOK-UHFFFAOYSA-N Synonym: h2dcfda,2-3,6-diacetoxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid,2',7'-dichlorohydrofluorescein diacetate,2,7-dichlorodihydrofluorescein diacetate,benzoic acid, 2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl,2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid,2′,7′-dichlorofluorescin diacetate,2′,7′-dichlorodihydrofluorescein diacetate,2-3,6-diacetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid PubChem CID: 77718 IUPAC Name: 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid SMILES: CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl
| PubChem CID | 77718 |
|---|---|
| CAS | 4091-99-0 |
| Molecular Weight (g/mol) | 487.285 |
| SMILES | CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl |
| Synonym | h2dcfda,2-3,6-diacetoxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid,2',7'-dichlorohydrofluorescein diacetate,2,7-dichlorodihydrofluorescein diacetate,benzoic acid, 2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl,2-3,6-bis acetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid,2′,7′-dichlorofluorescin diacetate,2′,7′-dichlorodihydrofluorescein diacetate,2-3,6-diacetyloxy-2,7-dichloro-9h-xanthen-9-yl benzoic acid |
| IUPAC Name | 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid |
| InChI Key | PXEZTIWVRVSYOK-UHFFFAOYSA-N |
| Molecular Formula | C24H16Cl2O7 |
Mercaptosuccinic acid, 98%
CAS: 70-49-5 Molecular Formula: C4H6O4S Molecular Weight (g/mol): 150.148 MDL Number: MFCD00004860 InChI Key: NJRXVEJTAYWCQJ-UHFFFAOYSA-N Synonym: mercaptosuccinic acid,thiomalic acid,2-thiomalic acid,2-mercaptosuccinic acid,monomercaptosuccinic acid,butanedioic acid, mercapto,malic acid, 2-thio,mercaptosuccinate,2-sulfanylsuccinic acid,dl-mercaptosuccinic acid PubChem CID: 6268 ChEBI: CHEBI:38705 IUPAC Name: 2-sulfanylbutanedioic acid SMILES: C(C(C(=O)O)S)C(=O)O
| PubChem CID | 6268 |
|---|---|
| CAS | 70-49-5 |
| Molecular Weight (g/mol) | 150.148 |
| ChEBI | CHEBI:38705 |
| MDL Number | MFCD00004860 |
| SMILES | C(C(C(=O)O)S)C(=O)O |
| Synonym | mercaptosuccinic acid,thiomalic acid,2-thiomalic acid,2-mercaptosuccinic acid,monomercaptosuccinic acid,butanedioic acid, mercapto,malic acid, 2-thio,mercaptosuccinate,2-sulfanylsuccinic acid,dl-mercaptosuccinic acid |
| IUPAC Name | 2-sulfanylbutanedioic acid |
| InChI Key | NJRXVEJTAYWCQJ-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4S |
2-Carbamoylbenzeneboronic acid, 96%
CAS: 380430-54-6 Molecular Formula: C7H8BNO3 Molecular Weight (g/mol): 164.955 MDL Number: MFCD02179454 InChI Key: LBWJTKOVBMVJJX-UHFFFAOYSA-N Synonym: 2-aminocarbonylphenylboronic acid,2-carbamoylphenyl boronic acid,2-carbamoylbenzeneboronic acid,2-aminocarbonyl benzeneboronic acid,2-boronobenzamide,boronic acid, 2-aminocarbonyl phenyl,2-aminocarbonylphenyl boronic acid,2-aminocarbonyl phenylboronic acid,boronic acid,b-2-aminocarbonyl phenyl,pubchem1766 PubChem CID: 2737809 IUPAC Name: (2-carbamoylphenyl)boronic acid SMILES: B(C1=CC=CC=C1C(=O)N)(O)O
| PubChem CID | 2737809 |
|---|---|
| CAS | 380430-54-6 |
| Molecular Weight (g/mol) | 164.955 |
| MDL Number | MFCD02179454 |
| SMILES | B(C1=CC=CC=C1C(=O)N)(O)O |
| Synonym | 2-aminocarbonylphenylboronic acid,2-carbamoylphenyl boronic acid,2-carbamoylbenzeneboronic acid,2-aminocarbonyl benzeneboronic acid,2-boronobenzamide,boronic acid, 2-aminocarbonyl phenyl,2-aminocarbonylphenyl boronic acid,2-aminocarbonyl phenylboronic acid,boronic acid,b-2-aminocarbonyl phenyl,pubchem1766 |
| IUPAC Name | (2-carbamoylphenyl)boronic acid |
| InChI Key | LBWJTKOVBMVJJX-UHFFFAOYSA-N |
| Molecular Formula | C7H8BNO3 |
Carbetapentane citrate
CAS: 23142-01-0 Molecular Formula: C26H39NO10 Molecular Weight (g/mol): 525.595 MDL Number: MFCD00055697 InChI Key: AKJDEXBCRLOVTH-UHFFFAOYSA-N Synonym: carbetapentane citrate,pentoxyverine citrate,loucarbate,pentoxiverine citrate,carbetapentane citrate salt,toclase,toclase citrate,carbetapentone citrate,unii-4sh0mfj5hj PubChem CID: 90010 IUPAC Name: 2-[2-(diethylamino)ethoxy]ethyl 1-phenylcyclopentane-1-carboxylate;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: CCN(CC)CCOCCOC(=O)C1(CCCC1)C2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O
| PubChem CID | 90010 |
|---|---|
| CAS | 23142-01-0 |
| Molecular Weight (g/mol) | 525.595 |
| MDL Number | MFCD00055697 |
| SMILES | CCN(CC)CCOCCOC(=O)C1(CCCC1)C2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Synonym | carbetapentane citrate,pentoxyverine citrate,loucarbate,pentoxiverine citrate,carbetapentane citrate salt,toclase,toclase citrate,carbetapentone citrate,unii-4sh0mfj5hj |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]ethyl 1-phenylcyclopentane-1-carboxylate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | AKJDEXBCRLOVTH-UHFFFAOYSA-N |
| Molecular Formula | C26H39NO10 |
Phthalimide, 98%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 85-41-6 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.13 InChI Key: XKJCHHZQLQNZHY-UHFFFAOYSA-N IUPAC Name: 2,3-dihydro-1H-isoindole-1,3-dione SMILES: O=C1NC(=O)C2=CC=CC=C12
| CAS | 85-41-6 |
|---|---|
| Molecular Weight (g/mol) | 147.13 |
| SMILES | O=C1NC(=O)C2=CC=CC=C12 |
| IUPAC Name | 2,3-dihydro-1H-isoindole-1,3-dione |
| InChI Key | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
N-(Hydroxymethyl)phthalimide, 97%
CAS: 118-29-6 Molecular Formula: C9H7NO3 Molecular Weight (g/mol): 177.16 MDL Number: MFCD00005899 InChI Key: MNSGOOCAMMSKGI-UHFFFAOYSA-N Synonym: n-hydroxymethyl phthalimide,n-hydroxymethylphthalimide,2-hydroxymethyl isoindoline-1,3-dione,phthalimidomethanol,phthalimidomethyl alcohol,n-methylolphthalimide,oxymethyl phthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxymethyl,hydroxymethylphthalimide,methanol, phthalimido PubChem CID: 8354 ChEBI: CHEBI:38816 IUPAC Name: 2-(hydroxymethyl)isoindole-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CO
| PubChem CID | 8354 |
|---|---|
| CAS | 118-29-6 |
| Molecular Weight (g/mol) | 177.16 |
| ChEBI | CHEBI:38816 |
| MDL Number | MFCD00005899 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CO |
| Synonym | n-hydroxymethyl phthalimide,n-hydroxymethylphthalimide,2-hydroxymethyl isoindoline-1,3-dione,phthalimidomethanol,phthalimidomethyl alcohol,n-methylolphthalimide,oxymethyl phthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxymethyl,hydroxymethylphthalimide,methanol, phthalimido |
| IUPAC Name | 2-(hydroxymethyl)isoindole-1,3-dione |
| InChI Key | MNSGOOCAMMSKGI-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO3 |
Oxamic acid, 98%
CAS: 471-47-6 Molecular Formula: C2H3NO3 Molecular Weight (g/mol): 89.05 MDL Number: MFCD00008006 InChI Key: SOWBFZRMHSNYGE-UHFFFAOYSA-N Synonym: 2-amino-2-oxoacetic acid,oxamate,acetic acid, aminooxo,oxalamic acid,oxamidic acid,glycine, 2-oxo,oxalic acid monoamide,amino oxo acetic acid,aminooxoacetic acid,oxamate repellent PubChem CID: 974 ChEBI: CHEBI:18058 IUPAC Name: oxamic acid SMILES: C(=O)(C(=O)O)N
| PubChem CID | 974 |
|---|---|
| CAS | 471-47-6 |
| Molecular Weight (g/mol) | 89.05 |
| ChEBI | CHEBI:18058 |
| MDL Number | MFCD00008006 |
| SMILES | C(=O)(C(=O)O)N |
| Synonym | 2-amino-2-oxoacetic acid,oxamate,acetic acid, aminooxo,oxalamic acid,oxamidic acid,glycine, 2-oxo,oxalic acid monoamide,amino oxo acetic acid,aminooxoacetic acid,oxamate repellent |
| IUPAC Name | oxamic acid |
| InChI Key | SOWBFZRMHSNYGE-UHFFFAOYSA-N |
| Molecular Formula | C2H3NO3 |
2,2-Dimethylbutyric acid, 97%
CAS: 595-37-9 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00004200 InChI Key: VUAXHMVRKOTJKP-UHFFFAOYSA-N Synonym: 2,2-dimethylbutyric acid,butanoic acid, 2,2-dimethyl,2,2-dimethyl-butanoic acid,2,2-dimethyl butyric acid,2,2-dimethyl butanoic acid,unii-ay606cn05o,butyric acid, 2,2-dimethyl,dimethyl ethyl acetic acid,2,2-dimethyl-butyric acid,.alpha.,.alpha.-dimethylbutyric acid PubChem CID: 11684 ChEBI: CHEBI:38649 IUPAC Name: 2,2-dimethylbutanoic acid SMILES: CCC(C)(C)C(=O)O
| PubChem CID | 11684 |
|---|---|
| CAS | 595-37-9 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:38649 |
| MDL Number | MFCD00004200 |
| SMILES | CCC(C)(C)C(=O)O |
| Synonym | 2,2-dimethylbutyric acid,butanoic acid, 2,2-dimethyl,2,2-dimethyl-butanoic acid,2,2-dimethyl butyric acid,2,2-dimethyl butanoic acid,unii-ay606cn05o,butyric acid, 2,2-dimethyl,dimethyl ethyl acetic acid,2,2-dimethyl-butyric acid,.alpha.,.alpha.-dimethylbutyric acid |
| IUPAC Name | 2,2-dimethylbutanoic acid |
| InChI Key | VUAXHMVRKOTJKP-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |